CymitQuimica logo

CAS 1280786-64-2

:

3-Bromo-N-(1,1-dimethylethyl)-5-(trifluoromethyl)-2-pyridinamine

Description:
3-Bromo-N-(1,1-dimethylethyl)-5-(trifluoromethyl)-2-pyridinamine is a chemical compound characterized by its unique structural features, which include a bromine atom and a trifluoromethyl group attached to a pyridine ring. The presence of the N-(1,1-dimethylethyl) substituent indicates a bulky alkyl group that can influence the compound's steric properties and reactivity. This compound is likely to exhibit moderate to high lipophilicity due to the trifluoromethyl group, which can enhance its biological activity and interaction with various targets. The bromine atom may also contribute to its reactivity, making it a potential candidate for further chemical transformations. In terms of applications, compounds with similar structures are often explored in medicinal chemistry for their potential as pharmaceuticals or agrochemicals. The specific properties, such as solubility, melting point, and stability, would depend on the compound's interactions with solvents and other chemical environments. Overall, this compound represents a class of halogenated pyridine derivatives with potential utility in various chemical and biological applications.
Formula:C10H12BrF3N2
InChI:InChI=1S/C10H12BrF3N2/c1-9(2,3)16-8-7(11)4-6(5-15-8)10(12,13)14/h4-5H,1-3H3,(H,15,16)
InChI key:InChIKey=ZVWGZFFDFKLWAS-UHFFFAOYSA-N
SMILES:N(C(C)(C)C)C1=C(Br)C=C(C(F)(F)F)C=N1
Synonyms:
  • 2-Pyridinamine, 3-bromo-N-(1,1-dimethylethyl)-5-(trifluoromethyl)-
  • 3-Bromo-N-(1,1-dimethylethyl)-5-(trifluoromethyl)-2-pyridinamine
  • 3-Bromo-N-t-butyl-5-(trifluoromethyl)pyridin-2-amine
  • 3-Bromo-2-(N-t-butylamino)-5-trifluoromethylpyridine
  • 3-BroMo-N-(tert-butyl)-5-(trifluoroMethyl)pyridin-2-aMine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.