CAS 1280786-65-3

Methyl 6-amino-3-[4-(1,1-dimethylethyl)phenyl]-2-pyridinecarboxylate

Description:

Methyl 6-amino-3-[4-(1,1-dimethylethyl)phenyl]-2-pyridinecarboxylate, identified by its CAS number 1280786-65-3, is a chemical compound characterized by its complex structure, which includes a pyridine ring and an amino group. This compound features a methyl ester functional group, contributing to its solubility properties and reactivity. The presence of a bulky tert-butyl group on the phenyl ring enhances its steric hindrance, potentially influencing its biological activity and interactions with other molecules. The amino group may participate in hydrogen bonding, which can affect the compound's solubility and reactivity in various solvents. This compound is of interest in medicinal chemistry and drug development due to its potential biological activities, which may include anti-inflammatory or anticancer properties. Its synthesis and characterization are essential for understanding its behavior in biological systems and its potential applications in pharmaceuticals. As with many organic compounds, safety and handling precautions should be observed due to possible toxicity or reactivity.

Formula: C₁₇H₂₀N₂O₂

InChI: InChI=1S/C17H20N2O2/c1-17(2,3)12-7-5-11(6-8-12)13-9-10-14(18)19-15(13)16(20)21-4/h5-10H,1-4H3,(H2,18,19)

InChI key: InChIKey=DXBKSVVZXZVJGD-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(C=CC(N)=N1)C2=CC=C(C(C)(C)C)C=C2

Synonyms:

• 2-Pyridinecarboxylic acid, 6-amino-3-[4-(1,1-dimethylethyl)phenyl]-, methyl ester
• Methyl 6-amino-3-[4-(1,1-dimethylethyl)phenyl]-2-pyridinecarboxylate

Methyl 6-amino-3-(4-t-butylphenyl)picolinate

CAS: 1280786-65-3

Formula: C₁₇H₂₀N₂O₂

Molecular weight: 284.3529

Ref: IN-DA000XRX