CAS 1280786-66-4
:4-Bromo-N-(1,1-dimethylethyl)-5-ethoxy-2-nitrobenzenamine
Description:
4-Bromo-N-(1,1-dimethylethyl)-5-ethoxy-2-nitrobenzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, an ethoxy group, and a nitro group attached to a benzene ring. The presence of the bromine substituent indicates potential reactivity in electrophilic aromatic substitution reactions. The bulky tert-butyl group (1,1-dimethylethyl) enhances the steric hindrance around the amine, which may influence its reactivity and solubility in various solvents. The nitro group is a strong electron-withdrawing group, which can affect the electronic properties of the compound, making it more reactive towards nucleophiles. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Additionally, the ethoxy group can enhance solubility in organic solvents, potentially facilitating its use in various applications, including pharmaceuticals and agrochemicals. Overall, the unique combination of functional groups in this compound contributes to its chemical behavior and potential applications.
Formula:C12H17BrN2O3
InChI:InChI=1S/C12H17BrN2O3/c1-5-18-11-7-9(14-12(2,3)4)10(15(16)17)6-8(11)13/h6-7,14H,5H2,1-4H3
InChI key:InChIKey=HXTPJLMWDWBTNX-UHFFFAOYSA-N
SMILES:N(C(C)(C)C)C1=C(N(=O)=O)C=C(Br)C(OCC)=C1
Synonyms:- 4-Bromo-N-(1,1-dimethylethyl)-5-ethoxy-2-nitrobenzenamine
- Benzenamine, 4-bromo-N-(1,1-dimethylethyl)-5-ethoxy-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
