CAS 1280786-69-7
:4-Bromo-5-methoxy-2-nitro-N-propylbenzenamine
Description:
4-Bromo-5-methoxy-2-nitro-N-propylbenzenamine is an organic compound characterized by its aromatic structure, which includes a bromine atom, a methoxy group, and a nitro group attached to a benzene ring. The presence of the amino group (benzenamine) indicates that it is an aniline derivative, which can influence its reactivity and solubility. The bromine substituent typically enhances electrophilic substitution reactions, while the nitro group is known for its electron-withdrawing properties, affecting the compound's overall electronic characteristics. The methoxy group, being an electron-donating group, can stabilize the aromatic system. This compound may exhibit various physical properties such as solubility in organic solvents and potential applications in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the presence of the propyl group suggests that it may have specific steric effects that could influence its reactivity and interactions with biological systems. Safety and handling precautions should be observed due to the potential toxicity associated with nitro and bromo compounds.
Formula:C10H13BrN2O3
InChI:InChI=1S/C10H13BrN2O3/c1-3-4-12-8-6-10(16-2)7(11)5-9(8)13(14)15/h5-6,12H,3-4H2,1-2H3
InChI key:InChIKey=YQYSDNLJABVUOY-UHFFFAOYSA-N
SMILES:N(CCC)C1=C(N(=O)=O)C=C(Br)C(OC)=C1
Synonyms:- 4-Bromo-5-methoxy-2-nitro-N-propylbenzenamine
- Benzenamine, 4-bromo-5-methoxy-2-nitro-N-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
