CAS 1280786-73-3

4-Chloro-3-(2-methylpropoxy)benzoic acid

Description:

4-Chloro-3-(2-methylpropoxy)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a chlorine atom and a 2-methylpropoxy group. The presence of the chlorine atom at the para position relative to the carboxylic acid group contributes to its chemical reactivity and potential applications in various chemical syntheses. The 2-methylpropoxy substituent enhances the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit properties typical of benzoic acids, such as acidity and the ability to form salts or esters. Its unique structure suggests potential utility in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety and handling considerations are essential, as with many chlorinated compounds, due to potential toxicity and environmental impact. Overall, 4-Chloro-3-(2-methylpropoxy)benzoic acid represents a versatile chemical entity with specific functional groups that dictate its reactivity and applications in various fields.

Formula: C₁₁H₁₃ClO₃

InChI: InChI=1S/C11H13ClO3/c1-7(2)6-15-10-5-8(11(13)14)3-4-9(10)12/h3-5,7H,6H2,1-2H3,(H,13,14)

InChI key: InChIKey=MIHGERMEJSCGDA-UHFFFAOYSA-N

SMILES: O(CC(C)C)C1=CC(C(O)=O)=CC=C1Cl

Synonyms:

• Benzoic acid, 4-chloro-3-(2-methylpropoxy)-
• 4-Chloro-3-(2-methylpropoxy)benzoic acid

4-Chloro-3-isobutoxybenzoic acid

CAS: 1280786-73-3

Formula: C₁₁H₁₃ClO₃

Molecular weight: 228.6721

Ref: IN-DA000XRP