CAS 1280786-74-4
:4-Bromo-N-propyl-2-pyridinamine
Description:
4-Bromo-N-propyl-2-pyridinamine is an organic compound characterized by its bromine substituent and a propyl group attached to a pyridine ring. The presence of the bromine atom introduces a halogen functionality, which can influence the compound's reactivity and solubility. The pyridine ring, a six-membered aromatic heterocycle containing one nitrogen atom, contributes to the compound's basicity and potential for coordination with metal ions. The amine functional group (–NH2) enhances its nucleophilicity, making it a candidate for various chemical reactions, including alkylation and acylation. This compound may exhibit biological activity, potentially serving as a building block in pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity, particularly due to the bromine atom. Overall, 4-Bromo-N-propyl-2-pyridinamine is a versatile compound with applications in synthetic organic chemistry and medicinal chemistry.
Formula:C8H11BrN2
InChI:InChI=1S/C8H11BrN2/c1-2-4-10-8-6-7(9)3-5-11-8/h3,5-6H,2,4H2,1H3,(H,10,11)
InChI key:InChIKey=VNJNFEXFJXRNDU-UHFFFAOYSA-N
SMILES:N(CCC)C1=CC(Br)=CC=N1
Synonyms:- 4-Bromo-N-propyl-2-pyridinamine
- 2-Pyridinamine, 4-bromo-N-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
