CAS 1280786-80-2: 5-Bromo-3-Chloro-2-fluorobenzaldehyde
Description:5-Bromo-3-chloro-2-fluorobenzaldehyde is an aromatic aldehyde characterized by the presence of bromine, chlorine, and fluorine substituents on a benzene ring. This compound features a benzaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of halogen atoms (bromine, chlorine, and fluorine) contributes to its unique chemical properties, such as increased electrophilicity and potential for further functionalization. The molecular structure allows for various interactions, making it useful in the development of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, the compound may exhibit distinct physical properties, including solubility in organic solvents and specific melting or boiling points, influenced by the halogen substituents. Its reactivity can be harnessed in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C7H3BrClFO
InChI:InChI=1S/C7H3BrClFO/c8-5-1-4(3-11)7(10)6(9)2-5/h1-3H
InChI key:InChIKey=PLYXMAYYYOIEJW-UHFFFAOYSA-N
SMILES:O=CC=1C=C(Br)C=C(Cl)C1F

Benzaldehyde, 5-bromo-3-chloro-2-fluoro-
Ref: IN-DA000XRI
1g | 49.00 € | ||
5g | 124.00 € | ||
10g | 169.00 € | ||
25g | 314.00 € | ||
100g | To inquire | ||
250mg | 28.00 € |

5-Bromo-3-chloro-2-fluorobenzaldehyde
Ref: 54-PC303452
1g | 54.00 € | ||
5g | 242.00 € |

Ref: 10-F215035
1g | 25.00 € | ||
5g | 98.00 € | ||
10g | 175.00 € | ||
25g | 304.00 € | ||
100g | 1,026.00 € | ||
250mg | 14.00 € |

5-bromo-3-chloro-2-fluorobenzaldehyde
Ref: 3D-FBC78680
5g | 471.00 € |