CAS 1280786-82-4
:1-(5-Bromo-2-fluorophenyl)pyrrolidine
Description:
1-(5-Bromo-2-fluorophenyl)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a substituted phenyl group. The presence of a bromine atom and a fluorine atom on the phenyl ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic heterocyclic compound due to the nitrogen atom in the pyrrolidine ring. Its molecular structure suggests that it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The bromine and fluorine substituents can influence the compound's lipophilicity, solubility, and interaction with biological targets. Additionally, the compound's synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in various research applications, including drug development and material science. Safety and handling precautions are essential when working with this compound, as halogenated organic compounds can pose health risks.
Formula:C10H11BrFN
InChI:InChI=1S/C10H11BrFN/c11-8-3-4-9(12)10(7-8)13-5-1-2-6-13/h3-4,7H,1-2,5-6H2
InChI key:InChIKey=BTRJHVUIVJNGBI-UHFFFAOYSA-N
SMILES:FC1=C(C=C(Br)C=C1)N2CCCC2
Synonyms:- Pyrrolidine, 1-(5-bromo-2-fluorophenyl)-
- 1-(5-Bromo-2-fluorophenyl)pyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
