CAS 1280786-85-7
:5-Bromo-1-butyl-1H-indazole
Description:
5-Bromo-1-butyl-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 5-position and a butyl group at the 1-position contributes to its unique properties. This compound is typically classified as a heterocyclic aromatic compound due to the nitrogen atoms in its structure. It may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. The bromine substituent can influence its reactivity and solubility, while the butyl group may affect its lipophilicity and interaction with biological targets. As with many indazole derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety and handling precautions should be observed, as with all chemical substances, particularly those that may have pharmacological effects or environmental implications.
Formula:C11H13BrN2
InChI:InChI=1S/C11H13BrN2/c1-2-3-6-14-11-5-4-10(12)7-9(11)8-13-14/h4-5,7-8H,2-3,6H2,1H3
InChI key:InChIKey=WZKCPFIDHKMCCK-UHFFFAOYSA-N
SMILES:C(CCC)N1C=2C(=CC(Br)=CC2)C=N1
Synonyms:- 5-Bromo-1-butyl-1H-indazole
- 1H-Indazole, 5-bromo-1-butyl-
- 5-Bromo-1-butylindazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
