CAS 1280786-90-4

3-Bromo-4-ethoxy-5-fluorobenzenamine

Description:

3-Bromo-4-ethoxy-5-fluorobenzenamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom, an ethoxy group, and a fluorine atom, along with an amino group. The presence of these substituents influences its chemical properties, such as reactivity and solubility. The bromine and fluorine atoms are electronegative, which can enhance the compound's reactivity in electrophilic aromatic substitution reactions. The ethoxy group contributes to the compound's hydrophobic character, while the amino group can participate in hydrogen bonding, affecting its solubility in polar solvents. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing other chemical entities. Additionally, its specific structural features may allow for interactions with biological targets, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₈H₉BrFNO

InChI: InChI=1S/C8H9BrFNO/c1-2-12-8-6(9)3-5(11)4-7(8)10/h3-4H,2,11H2,1H3

InChI key: InChIKey=BKPHRBXTKLFFHS-UHFFFAOYSA-N

SMILES: O(CC)C1=C(Br)C=C(N)C=C1F

Synonyms:

• 3-Bromo-4-ethoxy-5-fluorobenzenamine
• 3-Bromo-4-ethoxy-5-fluoroaniline
• Benzenamine, 3-bromo-4-ethoxy-5-fluoro-

3-Bromo-4-ethoxy-5-fluoroaniline

CAS: 1280786-90-4

Formula: C₈H₉BrFNO

Molecular weight: 234.0656

Ref: IN-DA000XSC