CAS 1280786-91-5
:1-(3-Bromo-4-chlorophenyl)-1-butanone
Description:
1-(3-Bromo-4-chlorophenyl)-1-butanone, identified by its CAS number 1280786-91-5, is an organic compound characterized by the presence of a butanone moiety attached to a phenyl group that is substituted with both bromine and chlorine atoms. This compound typically exhibits a molecular structure that includes a carbonyl group (C=O) as part of the butanone structure, contributing to its reactivity and potential applications in organic synthesis. The presence of halogen substituents, specifically bromine and chlorine, can influence the compound's physical properties, such as solubility and boiling point, as well as its chemical reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C10H10BrClO
InChI:InChI=1S/C10H10BrClO/c1-2-3-10(13)7-4-5-9(12)8(11)6-7/h4-6H,2-3H2,1H3
InChI key:InChIKey=BLFYNZPJCYTXPV-UHFFFAOYSA-N
SMILES:C(CCC)(=O)C1=CC(Br)=C(Cl)C=C1
Synonyms:- 1-(3-Bromo-4-chlorophenyl)-1-butanone
- 1-Butanone, 1-(3-bromo-4-chlorophenyl)-
- 2-Bromo-1-chloro-4-(propylcarbonyl)benzene
- 1-(3-Bromo-4-chlorophenyl)butan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
