CymitQuimica logo

CAS 1280786-93-7

:

1-(5-Bromo-2-fluorophenyl)-1-pentanone

Description:
1-(5-Bromo-2-fluorophenyl)-1-pentanone is an organic compound characterized by its structure, which includes a pentanone backbone and a substituted aromatic ring. The presence of a bromine atom and a fluorine atom on the phenyl group contributes to its unique reactivity and physical properties. This compound typically exhibits a moderate to high boiling point due to the presence of the carbonyl group, which can engage in dipole-dipole interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the synthesis of pharmaceuticals, due to the halogen substituents that can influence biological activity. Additionally, the compound may exhibit moderate solubility in organic solvents, while its solubility in water is likely limited due to the hydrophobic nature of the alkyl chain. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 1-(5-Bromo-2-fluorophenyl)-1-pentanone is a compound of interest in various chemical research fields.
Formula:C11H12BrFO
InChI:InChI=1S/C11H12BrFO/c1-2-3-4-11(14)9-7-8(12)5-6-10(9)13/h5-7H,2-4H2,1H3
InChI key:InChIKey=NXVFHYRTBOEYBO-UHFFFAOYSA-N
SMILES:C(CCCC)(=O)C1=C(F)C=CC(Br)=C1
Synonyms:
  • 1-(5-Bromo-2-fluorophenyl)-1-pentanone
  • 1-Pentanone, 1-(5-bromo-2-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.