CAS 1280786-94-8
:(3-Bromo-4-chlorophenyl)cyclopropylmethanone
Description:
(3-Bromo-4-chlorophenyl)cyclopropylmethanone is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a phenyl ring substituted with bromine and chlorine atoms. The presence of these halogen substituents typically influences the compound's reactivity and physical properties, such as solubility and boiling point. The cyclopropyl group, known for its strain and rigidity, can impart distinctive chemical behavior, making the compound potentially useful in various synthetic applications. This compound may exhibit biological activity, which is often explored in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular interactions can be influenced by the electron-withdrawing effects of the halogens, which can enhance or modify its reactivity in chemical reactions. As with many halogenated compounds, safety considerations are essential due to potential toxicity and environmental impact. Overall, (3-Bromo-4-chlorophenyl)cyclopropylmethanone represents a class of compounds that are of interest in both academic research and industrial applications.
Formula:C10H8BrClO
InChI:InChI=1S/C10H8BrClO/c11-8-5-7(3-4-9(8)12)10(13)6-1-2-6/h3-6H,1-2H2
InChI key:InChIKey=KYWLRCNRAPNWNL-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Br)=C(Cl)C=C1)C2CC2
Synonyms:- Methanone, (3-bromo-4-chlorophenyl)cyclopropyl-
- (3-Bromo-4-chlorophenyl)cyclopropylmethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
