CymitQuimica logo

CAS 1280786-95-9

:

1,1-Dimethylethyl N-(5-bromo-2-pyridinyl)-N-propylcarbamate

Description:
1,1-Dimethylethyl N-(5-bromo-2-pyridinyl)-N-propylcarbamate, identified by its CAS number 1280786-95-9, is a chemical compound that belongs to the class of carbamates. This substance features a branched alkyl group, specifically a tert-butyl group, which contributes to its steric properties. The presence of a brominated pyridine moiety indicates potential biological activity, as pyridine derivatives are often associated with various pharmacological effects. The compound's structure suggests it may exhibit lipophilicity due to the tert-butyl group, which can influence its solubility and permeability in biological systems. Additionally, the carbamate functional group is known for its reactivity and potential to form hydrogen bonds, which may play a role in its interaction with biological targets. Overall, this compound's unique structural features may render it of interest in medicinal chemistry and agrochemical applications, although specific biological activities and properties would require further investigation through empirical studies.
Formula:C13H19BrN2O2
InChI:InChI=1S/C13H19BrN2O2/c1-5-8-16(12(17)18-13(2,3)4)11-7-6-10(14)9-15-11/h6-7,9H,5,8H2,1-4H3
InChI key:InChIKey=VZDUUOKOSIHTEL-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)(CCC)C1=CC=C(Br)C=N1
Synonyms:
  • Carbamic acid, N-(5-bromo-2-pyridinyl)-N-propyl-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl N-(5-bromo-2-pyridinyl)-N-propylcarbamate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.