CAS 1280786-95-9: 1,1-Dimethylethyl N-(5-bromo-2-pyridinyl)-N-propylcarbamate

Description:1,1-Dimethylethyl N-(5-bromo-2-pyridinyl)-N-propylcarbamate, identified by its CAS number 1280786-95-9, is a chemical compound that belongs to the class of carbamates. This substance features a branched alkyl group, specifically a tert-butyl group, which contributes to its steric properties. The presence of a brominated pyridine moiety indicates potential biological activity, as pyridine derivatives are often associated with various pharmacological effects. The compound's structure suggests it may exhibit lipophilicity due to the tert-butyl group, which can influence its solubility and permeability in biological systems. Additionally, the carbamate functional group is known for its reactivity and potential to form hydrogen bonds, which may play a role in its interaction with biological targets. Overall, this compound's unique structural features may render it of interest in medicinal chemistry and agrochemical applications, although specific biological activities and properties would require further investigation through empirical studies.

Formula:C₁₃H₁₉BrN₂O₂

InChI:InChI=1S/C13H19BrN2O2/c1-5-8-16(12(17)18-13(2,3)4)11-7-6-10(14)9-15-11/h6-7,9H,5,8H2,1-4H3

InChI key:InChIKey=VZDUUOKOSIHTEL-UHFFFAOYSA-N

SMILES:O=C(OC(C)(C)C)N(C1=NC=C(Br)C=C1)CCC

Synonyms:
Carbamic acid, N-(5-bromo-2-pyridinyl)-N-propyl-, 1,1-dimethylethyl ester
1,1-Dimethylethyl N-(5-bromo-2-pyridinyl)-N-propylcarbamate

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Carbamic acid, N-(5-bromo-2-pyridinyl)-N-propyl-, 1,1-dimethylethyl ester REF: IN-DA000XS7CAS: 1280786-95-9	- - -	To inquire	Mon 24 Mar 25
tert-Butyl (5-bromopyridin-2-yl)(propyl)carbamate REF: 10-F213306CAS: 1280786-95-9	95.0%	- - -	Discontinued product
tert-Butyl (5-bromopyridin-2-yl)(propyl)carbamate REF: 3D-FB155579CAS: 1280786-95-9	Min. 95%	- - -	Discontinued product