CAS 1280786-96-0
:1-[(4-Bromophenyl)phenylmethyl]pyrrolidine
Description:
1-[(4-Bromophenyl)phenylmethyl]pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a phenyl group substituted with a bromine atom. This compound features a pyrrolidine moiety, a five-membered nitrogen-containing ring known for its presence in various natural and synthetic compounds. The presence of the 4-bromophenyl group enhances its lipophilicity and may influence its biological activity. The compound is likely to exhibit properties typical of amines, such as basicity, and may participate in hydrogen bonding due to the nitrogen atom in the pyrrolidine ring. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. Additionally, the bromine substituent may provide opportunities for further chemical modifications, making it a versatile intermediate in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, as the compound may pose health risks if not managed properly.
Formula:C17H18BrN
InChI:InChI=1S/C17H18BrN/c18-16-10-8-15(9-11-16)17(19-12-4-5-13-19)14-6-2-1-3-7-14/h1-3,6-11,17H,4-5,12-13H2
InChI key:InChIKey=DFLJXKKHZUELSW-UHFFFAOYSA-N
SMILES:C(C1=CC=C(Br)C=C1)(N2CCCC2)C3=CC=CC=C3
Synonyms:- 1-[(4-Bromophenyl)phenylmethyl]pyrrolidine
- Pyrrolidine, 1-[(4-bromophenyl)phenylmethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
