CAS 1280786-98-2
:5-Bromo-3-chloro-N-cyclohexyl-2-pyridinamine
Description:
5-Bromo-3-chloro-N-cyclohexyl-2-pyridinamine is an organic compound characterized by its heterocyclic structure, which includes a pyridine ring substituted with both bromine and chlorine atoms, as well as a cyclohexyl group attached to the nitrogen atom. This compound typically exhibits properties associated with halogenated amines, such as potential reactivity in nucleophilic substitution reactions due to the presence of the halogen substituents. The cyclohexyl group contributes to its hydrophobic characteristics, influencing its solubility in organic solvents. The presence of multiple functional groups may also impart biological activity, making it of interest in pharmaceutical research. Additionally, the compound's molecular structure suggests potential applications in agrochemicals or as intermediates in organic synthesis. Safety and handling considerations are important, as halogenated compounds can pose environmental and health risks. Overall, 5-Bromo-3-chloro-N-cyclohexyl-2-pyridinamine is a compound of interest in various chemical and biological contexts, warranting further investigation for its properties and applications.
Formula:C11H14BrClN2
InChI:InChI=1S/C11H14BrClN2/c12-8-6-10(13)11(14-7-8)15-9-4-2-1-3-5-9/h6-7,9H,1-5H2,(H,14,15)
InChI key:InChIKey=AZQYVKICKAXHGR-UHFFFAOYSA-N
SMILES:N(C1=C(Cl)C=C(Br)C=N1)C2CCCCC2
Synonyms:- 2-Pyridinamine, 5-bromo-3-chloro-N-cyclohexyl-
- 5-Bromo-3-chloro-N-cyclohexyl-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
