CAS 1280787-27-0

2-Thiazolamine, 4-(1,1-dimethylethyl)-N-methyl-, hydrobromide (1:1)

Description:

2-Thiazolamine, 4-(1,1-dimethylethyl)-N-methyl-, hydrobromide (1:1) is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic ring containing sulfur and nitrogen. The presence of a tert-butyl group (1,1-dimethylethyl) and a methyl group attached to the nitrogen atom contributes to its unique properties, including potential biological activity. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, although specific activity would depend on further studies. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound represents a class of thiazole derivatives that may have applications in drug development and other chemical research fields.

Formula: C₈H₁₄N₂S·BrH

InChI: InChI=1S/C8H14N2S.BrH/c1-8(2,3)6-5-11-7(9-4)10-6;/h5H,1-4H3,(H,9,10);1H

InChI key: InChIKey=KKUZNTVJTYJRSZ-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C=1N=C(NC)SC1.Br

Synonyms:

• 2-Thiazolamine, 4-(1,1-dimethylethyl)-N-methyl-, hydrobromide (1:1)

4-tert-Butyl-N-methyl-1,3-thiazol-2-amine hydrobromide

CAS: 1280787-27-0

4-tert-Butyl-N-methyl-1,3-thiazol-2-amine hydrobromide

Purity: 95%

Molecular weight: 251.19g/mol

Ref: 54-OR33592