CAS 128095-52-3: α-L-Idopyranosiduronic acid, 4-methyl-2-oxo-2H-1-benzopyran-7-yl, methyl ester

Description:α-L-Idopyranosiduronic acid, 4-methyl-2-oxo-2H-1-benzopyran-7-yl, methyl ester, identified by CAS number 128095-52-3, is a complex organic compound characterized by its unique structural features. It contains a pyranose ring, indicative of its sugar-like properties, and a uronic acid moiety, which suggests potential biological activity related to polysaccharides. The presence of a benzopyran moiety contributes to its aromatic characteristics and may influence its reactivity and interaction with other molecules. As a methyl ester, it likely exhibits increased lipophilicity, which can affect its solubility and permeability in biological systems. This compound may have applications in medicinal chemistry, particularly in the development of glycosylated drugs or as a potential bioactive agent due to its structural motifs. Its synthesis and characterization would typically involve techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its identity and purity. Overall, this compound represents a fascinating intersection of carbohydrate chemistry and organic synthesis, with potential implications in various fields, including pharmaceuticals and biochemistry.

Formula:C₁₇H₁₈O₉

InChI:InChI=1S/C17H18O9/c1-7-5-11(18)25-10-6-8(3-4-9(7)10)24-17-14(21)12(19)13(20)15(26-17)16(22)23-2/h3-6,12-15,17,19-21H,1-2H3/t12-,13-,14+,15+,17+/m0/s1

InChI key:InChIKey=GQDKDFCKXAEJCH-DEQQHWRFSA-N

SMILES:O=C1OC=2C=C(OC3OC(C(=O)OC)C(O)C(O)C3O)C=CC2C(=C1)C

Synonyms:
α-L-Idopyranosiduronic acid, 4-methyl-2-oxo-2H-1-benzopyran-7-yl, methyl ester

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	4-Methylumbelliferyl α-L-Idopyranosiduronic Acid Methyl Ester REF: TR-M334725CAS: 128095-52-3	- - -	114.00 €~256.00 €	Mon 07 Apr 25
	4-Methylumbelliferyl α-L-idopyranosiduronic acid methyl ester REF: 3D-DFA09552CAS: 128095-52-3	Min. 95%	331.00 €~1,393.00 €	Wed 07 May 25