CAS 128099-74-1: 1,3-BIS-(2,3-DIHYDRO-INDOL-1-YL)-PROPANE-1,3-DIONE
Description:1,3-Bis-(2,3-dihydro-indol-1-yl)-propane-1,3-dione, with the CAS number 128099-74-1, is an organic compound characterized by its unique structure that includes two indole moieties linked by a propane-1,3-dione framework. This compound typically exhibits properties associated with diketones, such as the ability to undergo tautomerization and participate in various chemical reactions, including condensation and cyclization. The presence of the indole rings contributes to its potential biological activity, as indole derivatives are known for their roles in pharmaceuticals and natural products. The compound may display solubility in organic solvents, and its reactivity can be influenced by the functional groups present in the indole rings. Additionally, it may exhibit fluorescence properties, making it of interest in materials science and biological imaging. Overall, 1,3-bis-(2,3-dihydro-indol-1-yl)-propane-1,3-dione is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C19H18N2O2
InChI:InChI=1/C19H18N2O2/c22-18(20-11-9-14-5-1-3-7-16(14)20)13-19(23)21-12-10-15-6-2-4-8-17(15)21/h1-8H,9-13H2
- Synonyms:
- 1,3-di(2,3-dihydro-1H-indol-1-yl)propane-1,3-dione
- 1,3-Bis-(2,3-dihydro-indol-1-yl)-propane-1,3-dione
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Indole, 1,1'-(1,3-dioxo-1,3-propanediyl)bis[2,3-dihydro- (9CI) REF: IN-DA000XTDCAS: 128099-74-1 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 1,3-Bis(2,3-dihydro-1H-indol-1-yl)propane-1,3-dione REF: 3D-DFA09974CAS: 128099-74-1 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 1,3-Bis(2,3-dihydro-1h-indol-1-yl)propane-1,3-dione REF: 10-F642378CAS: 128099-74-1 | 98% | - - - | Discontinued product |

1H-Indole, 1,1'-(1,3-dioxo-1,3-propanediyl)bis[2,3-dihydro- (9CI)
Ref: IN-DA000XTD
Undefined size | To inquire |

1,3-Bis(2,3-dihydro-1H-indol-1-yl)propane-1,3-dione
Ref: 3D-DFA09974
2500mg | 485.00 € |

1,3-Bis(2,3-dihydro-1h-indol-1-yl)propane-1,3-dione
Ref: 10-F642378
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
500mg | Discontinued | Request information |