CymitQuimica logo

CAS 128099-76-3

:

5-Acetyl-1,2-dihydro-6-hydroxy-4H-pyrrolo[3,2,1-ij]quinolin-4-one

Description:
5-Acetyl-1,2-dihydro-6-hydroxy-4H-pyrrolo[3,2,1-ij]quinolin-4-one, with the CAS number 128099-76-3, is a heterocyclic organic compound characterized by its complex fused ring structure, which includes both pyrrole and quinoline moieties. This compound typically exhibits a range of chemical properties due to the presence of functional groups such as the acetyl and hydroxyl groups, which can influence its reactivity and solubility. It may display biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's structure allows for potential interactions with biological targets, and it may be studied for its effects in various biochemical pathways. Additionally, its unique arrangement of atoms contributes to its spectral characteristics, which can be analyzed using techniques such as NMR and UV-Vis spectroscopy. Overall, 5-Acetyl-1,2-dihydro-6-hydroxy-4H-pyrrolo[3,2,1-ij]quinolin-4-one represents a fascinating subject for research in both synthetic and applied chemistry contexts.
Formula:C13H11NO3
InChI:InChI=1S/C13H11NO3/c1-7(15)10-12(16)9-4-2-3-8-5-6-14(11(8)9)13(10)17/h2-4,16H,5-6H2,1H3
InChI key:InChIKey=KUYISNWBBZFVQK-UHFFFAOYSA-N
SMILES:O=C1N2C3=C(C(O)=C1C(C)=O)C=CC=C3CC2
Synonyms:
  • 5-Acetyl-1,2-dihydro-6-hydroxy-4H-pyrrolo[3,2,1-ij]quinolin-4-one
  • 4H-Pyrrolo[3,2,1-ij]quinolin-4-one, 5-acetyl-1,2-dihydro-6-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.