CAS 128114-56-7
:H-Gly-Gly-His-Gly-OH
Description:
The chemical substance known as H-Gly-Gly-His-Gly-OH, with the CAS number 128114-56-7, is a peptide composed of four amino acids: glycine (Gly), histidine (His), and an additional glycine. It features an N-terminal histidine and a C-terminal hydroxyl group, which can influence its solubility and reactivity. This peptide is often studied for its potential biological activities, including roles in signaling pathways and as a building block in larger peptide synthesis. Its structure allows for various conformations, which can affect its interaction with biological targets. The presence of histidine may impart unique properties, such as buffering capacity and metal ion coordination. Additionally, the peptide's relatively small size makes it suitable for various applications in biochemistry and pharmacology, including drug design and development. Overall, H-Gly-Gly-His-Gly-OH exemplifies the complexity and versatility of peptides in biological systems.
Formula:C12H18N6O5
InChI:InChI=1/C12H18N6O5/c13-2-9(19)15-4-10(20)18-8(1-7-3-14-6-17-7)12(23)16-5-11(21)22/h3,6,8H,1-2,4-5,13H2,(H,14,17)(H,15,19)(H,16,23)(H,18,20)(H,21,22)/t8-/m0/s1
SMILES:C(c1cnc[nH]1)[C@@H](C(=NCC(=O)O)O)N=C(CN=C(CN)O)O
Synonyms:- glycylglycyl-L-histidylglycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Gly-Gly-His-Gly-OH
CAS:H-Gly-Gly-His-Gly-OH is a tripeptide with a molecular weight of 778.09 g/mol. It is crosslinked to the side chain of lysine residues and can be used for the crosslinking of protein fibers, such as wool or silk, to form hydrophobic materials that are both resistant to shrinkage and have good thermal stability. The crosslinking reaction can be achieved by either the hypobromous acid oxidation or by inorganic oxidants such as hydrogen peroxide. H-Gly-Gly-His-Gly-OH has axial reactive radicals at its center which facilitates the formation of covalent links with other molecules.br> br> The yield depends on the type of reactant used and ranges from 47% (hydrogen peroxide) to 60% (hypobromous acid). The residue obtained after hydrolysis is an alpha amino acid consisting ofFormula:C12H18N6O5Purity:Min. 95%Color and Shape:PowderMolecular weight:326.31 g/mol

