CAS 128117-22-6
:Benzyl 3-Hydroxyazetidine-1-Carboxylate
Description:
Benzyl 3-Hydroxyazetidine-1-Carboxylate is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. The presence of a hydroxyl group at the 3-position and a carboxylate group at the 1-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The benzyl group enhances its lipophilicity, which may influence its biological activity and solubility in organic solvents. This compound can serve as an intermediate in the synthesis of various pharmaceuticals and biologically active molecules. Its unique structural features allow for potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's stability, solubility, and reactivity can vary depending on the specific conditions under which it is handled, such as pH and temperature. As with many organic compounds, proper safety measures should be taken when handling Benzyl 3-Hydroxyazetidine-1-Carboxylate to avoid exposure and ensure safe laboratory practices.
Formula:C11H13NO3
InChI:InChI=1/C11H13NO3/c13-10-6-12(7-10)11(14)15-8-9-4-2-1-3-5-9/h1-5,10,13H,6-8H2
SMILES:c1ccc(cc1)COC(=O)N1CC(C1)O
Synonyms:- N-Cbz-3-hydroxyazetidine
- 1-Cbz-3-hydroxyazetidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Azetidinecarboxylic acid, 3-hydroxy-, phenylmethyl ester
CAS:Formula:C11H13NO3Purity:96%Color and Shape:SolidMolecular weight:207.22583-Hydroxy-azetidine-1-carboxylic acid benzyl ester
CAS:3-Hydroxy-azetidine-1-carboxylic acid benzyl esterFormula:C11H13NO3Purity:99%Color and Shape: white solidMolecular weight:207.23g/mol1-N-Cbz-3-Hydroxyazetidine
CAS:Formula:C11H13NO3Purity:96%Color and Shape:Solid, White powderMolecular weight:207.2291-Cbz-3-hydroxyazetidine
CAS:1-Cbz-3-hydroxyazetidine is used for permanent conjugation in peptide or protein bioconjugates. Thanks to the Cbz-protected azetidine ring, it makes it useful for creating controlled conjugation and drug delivery systems. It is chemically stable under standard conditions.
Formula:C11H13NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:207.23 g/mol



