CAS 128118-34-3
:2-amino-5-methyl-4-phenylthiophene-3-carboxamide
Description:
2-Amino-5-methyl-4-phenylthiophene-3-carboxamide is a chemical compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2) that contribute to its polar characteristics, enhancing its solubility in polar solvents. The presence of a methyl group and a phenyl group on the thiophene ring adds to its complexity and may influence its electronic properties and reactivity. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in organic synthesis. Its molecular structure suggests that it may participate in hydrogen bonding, which can affect its interactions with biological targets or other chemical species. Additionally, the specific arrangement of substituents on the thiophene ring can lead to unique optical and electronic properties, making it a candidate for further research in drug development or as a functional material.
Formula:C12H12N2OS
InChI:InChI=1/C12H12N2OS/c1-7-9(8-5-3-2-4-6-8)10(11(13)15)12(14)16-7/h2-6H,14H2,1H3,(H2,13,15)
SMILES:Cc1c(c2ccccc2)c(C(=O)N)c(N)s1
Synonyms:- 3-Thiophenecarboxamide, 2-Amino-5-Methyl-4-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
