CAS 128139-14-0
:N-{1-cyclohexyl-3-hydroxy-7-methyl-5-[(2-methylbutyl)carbamoyl]octan-2-yl}-Nalpha-[3-(naphthalen-1-yl)-2-(naphthalen-1-ylmethyl)propanoyl]histidinamide
Description:
N-{1-cyclohexyl-3-hydroxy-7-methyl-5-[(2-methylbutyl)carbamoyl]octan-2-yl}-Nα-[3-(naphthalen-1-yl)-2-(naphthalen-1-ylmethyl)propanoyl]histidinamide, with CAS number 128139-14-0, is a complex organic compound characterized by its intricate structure, which includes multiple functional groups and a significant degree of stereochemistry. This substance features a histidine-derived backbone, indicating potential biological activity, particularly in pharmacological contexts. The presence of naphthalene moieties suggests that it may exhibit aromatic properties, which can influence its solubility and interaction with biological targets. The cyclohexyl and methylbutyl substituents contribute to its hydrophobic characteristics, potentially affecting its membrane permeability and bioavailability. Additionally, the hydroxyl group may participate in hydrogen bonding, enhancing its interactions with biological macromolecules. Overall, this compound's unique structural features suggest it could be of interest in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. However, detailed studies would be necessary to elucidate its precise properties and potential applications.
Formula:C51H67N5O4
InChI:InChI=1/C51H67N5O4/c1-5-35(4)31-53-49(58)41(25-34(2)3)29-48(57)46(26-36-15-7-6-8-16-36)55-51(60)47(30-43-32-52-33-54-43)56-50(59)42(27-39-21-13-19-37-17-9-11-23-44(37)39)28-40-22-14-20-38-18-10-12-24-45(38)40/h9-14,17-24,32-36,41-42,46-48,57H,5-8,15-16,25-31H2,1-4H3,(H,52,54)(H,53,58)(H,55,60)(H,56,59)
Synonyms:- 1H-imidazole-4-propanamide, N-[1-(cyclohexylmethyl)-2-hydroxy-6-methyl-4-[[(2-methylbutyl)amino]carbonyl]heptyl]-alpha-[[3-(1-naphthalenyl)-2-(1-naphthalenylmethyl)-1-oxopropyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
PD 125967
CAS:PD 125967 is a renin inhibitor, which represents a group of pharmaceutical drugs used primarily to treat essential hypertension.Formula:C51H67N5O4Color and Shape:SolidMolecular weight:814.11
