CAS 128139-63-9
:4-butoxy-3-methoxy-5-prop-2-en-1-ylbenzaldehyde
Description:
4-Butoxy-3-methoxy-5-prop-2-en-1-ylbenzaldehyde, with the CAS number 128139-63-9, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a butoxy group and a methoxy group, contributing to its solubility and reactivity. The presence of the prop-2-en-1-yl substituent indicates that it has an alkene functionality, which can participate in various chemical reactions, such as polymerization or addition reactions. The compound is likely to be a colorless to pale yellow liquid, exhibiting a characteristic aromatic odor. Its molecular structure suggests potential applications in organic synthesis, fragrance formulation, or as an intermediate in the production of other chemical compounds. Additionally, the presence of multiple functional groups may influence its physical properties, such as boiling point and solubility in different solvents. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards.
Formula:C15H20O3
InChI:InChI=1/C15H20O3/c1-4-6-8-18-15-13(7-5-2)9-12(11-16)10-14(15)17-3/h5,9-11H,2,4,6-8H2,1,3H3
SMILES:CCCCOc1c(CC=C)cc(cc1OC)C=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
