CymitQuimica logo

CAS 128147-28-4

:

1-Chloro-4-[(1-methylethyl)sulfonyl]butane

Description:
1-Chloro-4-[(1-methylethyl)sulfonyl]butane, with the CAS number 128147-28-4, is an organic compound characterized by its chloroalkane structure. It features a butane backbone with a chlorine atom attached to the first carbon and a sulfonyl group linked to the fourth carbon. The presence of the isopropyl sulfonyl group contributes to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid, exhibiting moderate polarity due to the sulfonyl group, which can influence its solubility in various solvents. It may participate in nucleophilic substitution reactions, making it useful in the synthesis of more complex molecules. Additionally, the chlorine atom can serve as a leaving group in chemical reactions. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose environmental and health risks. Overall, 1-Chloro-4-[(1-methylethyl)sulfonyl]butane is a valuable intermediate in chemical synthesis and research.
Formula:C7H15ClO2S
InChI:InChI=1S/C7H15ClO2S/c1-7(2)11(9,10)6-4-3-5-8/h7H,3-6H2,1-2H3
InChI key:InChIKey=LINKIHXFMCKCDE-UHFFFAOYSA-N
SMILES:S(CCCCCl)(C(C)C)(=O)=O
Synonyms:
  • Butane, 1-chloro-4-[(1-methylethyl)sulfonyl]-
  • 1-Chloro-4-[(1-methylethyl)sulfonyl]butane
  • 1-Chloro-4-(propane-2-sulfonyl)butane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.