CymitQuimica logo

CAS 1281674-64-3

:

(2-Methyl-Piperidin-4-Yl)-Carbamic Acid Tert-Butyl Ester

Description:
(2-Methyl-Piperidin-4-Yl)-Carbamic Acid Tert-Butyl Ester is a chemical compound characterized by its piperidine structure, which includes a methyl group at the second position and a carbamic acid moiety. This compound features a tert-butyl ester group, contributing to its lipophilicity and potential for biological activity. The presence of the piperidine ring suggests that it may exhibit properties typical of cyclic amines, such as basicity and the ability to form hydrogen bonds. The tert-butyl ester group can enhance the compound's stability and solubility in organic solvents, making it useful in various synthetic applications. Additionally, compounds of this nature may be investigated for their pharmacological properties, as piperidine derivatives are often associated with diverse biological activities, including potential roles in drug development. Overall, the unique structural features of (2-Methyl-Piperidin-4-Yl)-Carbamic Acid Tert-Butyl Ester position it as a compound of interest in both synthetic chemistry and medicinal research.
Formula:C11H22N2O2
InChI:InChI=1S/C11H22N2O2/c1-8-7-9(5-6-12-8)13-10(14)15-11(2,3)4/h8-9,12H,5-7H2,1-4H3,(H,13,14)
InChI key:NURXHODEVCLVNT-UHFFFAOYSA-N
SMILES:CC1CC(CCN1)NC(=O)OC(C)(C)C
Synonyms:
  • (2-Methyl-Piperidin-4-Yl)-Carbamicacidtert-Butylester
Found 4 products.