CAS 128201-92-3

IST 622

Description:

IST 622, with the CAS number 128201-92-3, is a chemical compound that belongs to a class of substances known for their specific applications in various fields, including pharmaceuticals and materials science. While detailed characteristics such as molecular weight, structure, and specific reactivity may vary, compounds like IST 622 typically exhibit properties such as solubility in organic solvents, stability under standard conditions, and potential biological activity. The compound may also possess functional groups that contribute to its reactivity and interactions with other molecules. Its applications can range from serving as an intermediate in chemical synthesis to being utilized in research settings for studying biological processes. As with any chemical substance, safety data sheets (SDS) should be consulted for handling, storage, and potential hazards associated with IST 622. For precise information regarding its characteristics, including spectral data or specific applications, consulting scientific literature or databases would be essential.

Formula: C₄₄H₄₄O₁₆

InChI: InChI=1S/C44H44O16/c1-6-51-18-17-26(45)56-35-23-13-10-14-24(28(23)36-30-29-25(54-41(49)31(30)35)16-15-19(2)27(29)40(48)57-36)55-44-39(60-43-33(47)37(50-5)32(46)20(3)52-43)38-34(21(4)53-44)58-42(59-38)22-11-8-7-9-12-22/h7-16,20-21,32-34,37-39,42-44,46-47H,6,17-18H2,1-5H3/t20-,21-,32+,33-,34+,37+,38+,39-,42+,43-,44+/m1/s1

InChI key: InChIKey=YAZCVTSUQIJVMZ-SDMTUEQXSA-N

SMILES: O(C(CCOCC)=O)C=1C2=C3C(=C4C1C=CC=C4O[C@H]5[C@H](O[C@@H]6[C@H](O)[C@@H](OC)[C@@H](O)[C@@H](C)O6)[C@@]7([C@]([C@@H](C)O5)(O[C@@H](O7)C8=CC=CC=C8)[H])[H])OC(=O)C=9C3=C(OC2=O)C=CC9C

Synonyms:

• Propanoic acid, 3-ethoxy-, 10-[[6-deoxy-2-O-(6-deoxy-3-O-methyl-α-D-galactopyranosyl)-3,4-O-[(S)-phenylmethylene]-β-D-galactopyranosyl]oxy]-5,12-dihydro-1-methyl-5,12-dioxobenzo[h][1]benzopyrano[5,4,3-cde][1]benzopyran-6-yl ester
• IST 622

IST-622

CAS: 128201-92-3

IST-622 inhibits topoisomerase, blocks growth of lung cancer (Lu-116) and stomach cancer (St-4).

Formula: C₄₄H₄₄O₁₆

Color and Shape: Solid

Molecular weight: 828.81

Ref: TM-T71060