CymitQuimica logo

CAS 128229-95-8

:

BENZYL (2,2,2-TRIFLUORO-1-TRIFLUOROMETHYL-ETHYLIDENE)-CARBAMATE

Description:
Benzyl (2,2,2-trifluoro-1-trifluoromethyl-ethylidene)-carbamate, with CAS number 128229-95-8, is a chemical compound characterized by its unique trifluoromethyl groups, which significantly influence its chemical properties and reactivity. This compound features a benzyl group attached to a carbamate functional group, providing it with potential applications in organic synthesis and as a building block in pharmaceuticals. The presence of multiple fluorine atoms enhances its lipophilicity and stability, making it resistant to metabolic degradation. Additionally, the trifluoromethyl groups can impart unique electronic properties, affecting the compound's interaction with biological systems. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be influenced by the presence of the carbamate moiety, which can participate in various chemical reactions, including nucleophilic substitutions and hydrolysis. Overall, this compound's distinctive structure and functional groups make it of interest in both research and industrial applications, particularly in the development of fluorinated compounds.
Formula:C11H7F6NO2
InChI:InChI=1/C11H7F6NO2/c12-10(13,14)8(11(15,16)17)18-9(19)20-6-7-4-2-1-3-5-7/h1-5H,6H2
SMILES:c1ccc(cc1)COC(=O)N=C(C(F)(F)F)C(F)(F)F
Synonyms:
  • Hexafluoroacetone N-Benzyloxycarbonyl Imine
  • (2,2,2-Trifluoro-1-Trifluoromethyl-Ethylidene)-Carbamate
  • Benzyl (2,2,2-Trifluoro-1-trifluoromethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.