CAS 128241-72-5
:3-Phosphono-D-alanine
Description:
3-Phosphono-D-alanine is an amino acid derivative characterized by the presence of a phosphono group attached to the D-alanine structure. This compound features a chiral center, which contributes to its stereochemistry, making it a D-enantiomer. The phosphono group imparts unique properties, such as increased polarity and potential for forming hydrogen bonds, which can influence its solubility and reactivity in biological systems. 3-Phosphono-D-alanine is often studied for its role in biochemical pathways, particularly in relation to neurotransmission and metabolic processes. Its structural similarity to natural amino acids allows it to participate in various biochemical interactions, making it of interest in pharmaceutical and biochemical research. Additionally, the presence of the phosphono group may enhance its stability and bioactivity compared to other amino acids. Overall, 3-Phosphono-D-alanine serves as a valuable compound in the study of amino acid functionality and its applications in medicinal chemistry.
Formula:C3H8NO5P
InChI:InChI=1S/C3H8NO5P/c4-2(3(5)6)1-10(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m1/s1
InChI key:InChIKey=LBTABPSJONFLPO-UWTATZPHSA-N
SMILES:[C@@H](CP(=O)(O)O)(C(O)=O)N
Synonyms:- (2S)-2-Amino-3-phosphonopropanoic acid
- (2S)-2-ammonio-3-phosphonatopropanoate
- (S)-(-)-2-Amino-3-phosphonopropionic acid, 3-Phosphono-D-alanine, D-AP3
- (S)-2-Amino-3-phosphonopropanoic acid
- 3-Phosphono-<span class="text-smallcaps">D</span>-alanine
- 3-Phosphono-D-Alanine
- <span class="text-smallcaps">D</span>-2-Amino-3-phosphonopropionic acid
- <span class="text-smallcaps">D</span>-Alanine, 3-phosphono-
- D(-)-2-Amino-3-Phosphonopropanoic Acid
- D(-)-2-Amino-3-Phosphonopropionic Acid
- S(-)-2-Amino-3-Phosphonopropionic Acid
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
