CAS 1282518-60-8
:1-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Description:
1-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a boron-containing dioxaborolane moiety. The presence of the isopropyl group contributes to its hydrophobic properties, while the dioxaborolane unit enhances its reactivity, particularly in organic synthesis and potential applications in medicinal chemistry. This compound may exhibit interesting biological activities due to the pyrazole framework, which is known for its presence in various pharmaceuticals. Its boron-containing structure can facilitate interactions with biological targets, making it a candidate for further research in drug development. Additionally, the compound's stability and solubility can be influenced by the substituents on the pyrazole and dioxaborolane, affecting its overall reactivity and potential applications. As with many boron-containing compounds, it may also play a role in catalysis or as a reagent in organic transformations. Overall, this compound represents a versatile structure with potential applications in various fields of chemistry.
Formula:C12H21BN2O2
InChI:InChI=1S/C12H21BN2O2/c1-9(2)15-10(7-8-14-15)13-16-11(3,4)12(5,6)17-13/h7-9H,1-6H3
SMILES:CC(C)n1c(ccn1)B1OC(C)(C)C(C)(C)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1H-Pyrazole, 1-(1-methylethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
CAS:Formula:C12H21BN2O2Purity:97%Color and Shape:SolidMolecular weight:236.11831-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
CAS:1-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazoleFormula:C12H21BN2O2Purity:97%Color and Shape: white to off-white solidMolecular weight:236.12g/mol1-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
CAS:1-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is a compound with a high quality and versatile building blocks. It can be used as a reagent in organic synthesis and as a research chemical. CAS No. 1282518-60-8.Formula:C12H21BN2O2Purity:Min. 98 Area-%Color and Shape:Colorless PowderMolecular weight:236.12 g/mol1-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
CAS:Formula:C12H21BN2O2Purity:95%Color and Shape:SolidMolecular weight:236.12




