CAS 128258-74-2

4,5-Bis[(2-chloroethyl)thio]-1,3-dithiol-2-one

Description:

4,5-Bis[(2-chloroethyl)thio]-1,3-dithiol-2-one, identified by its CAS number 128258-74-2, is a synthetic organic compound characterized by its unique structure, which includes two thioether groups and a dithiolone moiety. This compound typically exhibits properties associated with sulfur-containing heterocycles, such as potential reactivity due to the presence of the dithiolone functional group, which can participate in various chemical reactions, including nucleophilic substitutions. The chloroethyl substituents suggest that it may possess cytotoxic properties, making it of interest in medicinal chemistry, particularly in the development of antitumor agents. Additionally, the presence of chlorine atoms may enhance lipophilicity, influencing its bioavailability and interaction with biological targets. The compound's stability, solubility, and reactivity can vary depending on environmental conditions, such as pH and temperature. Overall, 4,5-Bis[(2-chloroethyl)thio]-1,3-dithiol-2-one represents a class of compounds that may have significant implications in pharmaceutical applications and chemical synthesis.

Formula: C₇H₈Cl₂OS₄

InChI: InChI=1S/C7H8Cl2OS4/c8-1-3-11-5-6(12-4-2-9)14-7(10)13-5/h1-4H2

InChI key: InChIKey=ZRPZTICAFOPFAF-UHFFFAOYSA-N

SMILES: S(CCCl)C1=C(SCCCl)SC(=O)S1

Synonyms:

• 4,5-Bis[(2-chloroethyl)thio]-1,3-dithiol-2-one
• 1,3-Dithiol-2-one, 4,5-bis[(2-chloroethyl)thio]-

1,3-Dithiol-2-one, 4,5-bis[(2-chloroethyl)thio]-

CAS: 128258-74-2

Formula: C₇H₈Cl₂OS₄

Molecular weight: 307.3038

Ref: IN-DA000XXC