CAS 128299-96-7
:Octyl 2,3,4,6-O-Tetraacetyl-b-D-mannopyranoside
Description:
Octyl 2,3,4,6-O-Tetraacetyl-β-D-mannopyranoside is a glycoside derivative of mannose, characterized by the presence of an octyl group and four acetyl groups attached to the sugar moiety. This compound is typically used in biochemical research and applications involving carbohydrate chemistry. Its structure features a hydrophobic octyl chain, which enhances its solubility in organic solvents, while the acetyl groups provide protection to the hydroxyl groups of the mannopyranoside, influencing its reactivity and stability. The presence of these functional groups allows for various applications, including as a surfactant or in the synthesis of more complex carbohydrate structures. The compound is generally stable under standard laboratory conditions but should be handled with care due to the potential reactivity of the acetyl groups. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and solvents used in experiments. Overall, Octyl 2,3,4,6-O-Tetraacetyl-β-D-mannopyranoside serves as a valuable tool in the study of glycosides and carbohydrate interactions.
Formula:C22H36O10
InChI:InChI=1/C22H36O10/c1-6-7-8-9-10-11-12-27-22-21(31-17(5)26)20(30-16(4)25)19(29-15(3)24)18(32-22)13-28-14(2)23/h18-22H,6-13H2,1-5H3/t18?,19-,20+,21-,22-/m1/s1
Synonyms:- Octyl b-D-Mannopyranoside Tetraacetate
- Octyl 2,3,4,6-O-Tetraacetyl--D-mannopyranoside
- Octyl -D-Mannopyranoside Tetraacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Octyl 2,3,4,6-tetra-O-acetyl-b-D-mannopyranoside
CAS:<p>Octyl 2,3,4,6-tetra-O-acetyl-b-D-mannopyranoside is a glycosylated monosaccharide. This sugar is synthesized by the enzymatic action of acetyl CoA:mannose 3-O-acetyltransferase and bromoacetamidomalonic acid in the presence of ATP. The product of this reaction is an acetamidomalonic acid derivative with a beta (1,2)-linked mannose at C2 and an acetylated alpha (1,3)-linked mannose at C4. The compound has been shown to inhibit the growth of bacteria that are resistant to penicillin, ampicillin, and erythromycin.</p>Formula:C22H36O10Purity:Min. 95%Molecular weight:460.52 g/mol


