CymitQuimica logo

CAS 1283108-16-6

:

2-Fluoro-5-(3-methylimidazo[2,1-b]thiazol-6-yl)benzenamine

Description:
2-Fluoro-5-(3-methylimidazo[2,1-b]thiazol-6-yl)benzenamine is a chemical compound characterized by its complex structure, which includes a fluorine atom, a benzene ring, and an imidazo-thiazole moiety. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its biological activity. The imidazo[2,1-b]thiazole fragment is known for its potential pharmacological properties, often associated with various biological activities, including antimicrobial and anticancer effects. The compound's amine functional group can participate in hydrogen bonding, which may affect its solubility and reactivity. Additionally, the specific arrangement of substituents on the benzene ring and the imidazole-thiazole structure can lead to unique electronic properties, making it of interest in medicinal chemistry and drug design. Overall, this compound's characteristics suggest potential applications in pharmaceuticals, although further studies would be necessary to fully elucidate its biological effects and mechanisms of action.
Formula:C12H10FN3S
InChI:InChI=1S/C12H10FN3S/c1-7-6-17-12-15-11(5-16(7)12)8-2-3-9(13)10(14)4-8/h2-6H,14H2,1H3
InChI key:InChIKey=KDEVNXJQAOJEBR-UHFFFAOYSA-N
SMILES:NC=1C=C(C2=CN3C(=N2)SC=C3C)C=CC1F
Synonyms:
  • Benzenamine, 2-fluoro-5-(3-methylimidazo[2,1-b]thiazol-6-yl)-
  • 2-Fluoro-5-(3-methylimidazo[2,1-b]thiazol-6-yl)benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.