CAS 1283108-40-6

2-(3-Pyridinylamino)-4-thiazolecarboxylic acid

Description:

2-(3-Pyridinylamino)-4-thiazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyridine ring and a thiazole moiety. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids, such as potential acidity due to the carboxylic acid functional group. The presence of the pyridine ring may contribute to its ability to participate in hydrogen bonding and its overall polarity, influencing its solubility in various solvents. Additionally, the thiazole ring can impart biological activity, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The compound's reactivity may be influenced by the functional groups present, allowing for various synthetic modifications. Overall, 2-(3-Pyridinylamino)-4-thiazolecarboxylic acid is a versatile compound with potential applications in both research and industry, particularly in the fields of organic synthesis and drug development.

Formula: C₉H₇N₃O₂S

InChI: InChI=1S/C9H7N3O2S/c13-8(14)7-5-15-9(12-7)11-6-2-1-3-10-4-6/h1-5H,(H,11,12)(H,13,14)

InChI key: InChIKey=DAVHHVODAQQKNH-UHFFFAOYSA-N

SMILES: N(C1=NC(C(O)=O)=CS1)C=2C=CC=NC2

Synonyms:

• 2-(Pyridin-3-ylamino)-1,3-thiazole-4-carboxylic acid
• 4-Thiazolecarboxylic acid, 2-(3-pyridinylamino)-
• 2-(3-Pyridinylamino)-4-thiazolecarboxylic acid
• 2-(Pyridin-3-ylamino)thiazole-4-carboxylic acid
• 2-[(Pyridin-3-yl)amino]-1,3-thiazole-4-carboxylic acid

2-(3-Pyridylamino)-1,3-thiazole-4-carboxylic acid

CAS: 1283108-40-6

Please enquire for more information about 2-(3-Pyridylamino)-1,3-thiazole-4-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₉H₇N₃O₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 221.24 g/mol

Ref: 3D-FP169359