CymitQuimica logo

CAS 1283108-41-7

:

4-Methyl-2-(4-piperidinyloxy)benzothiazole

Description:
4-Methyl-2-(4-piperidinyloxy)benzothiazole is a chemical compound characterized by its unique structure, which includes a benzothiazole core substituted with a methyl group and a piperidinyloxy moiety. This compound typically exhibits properties associated with both the benzothiazole and piperidine functional groups, such as potential biological activity and solubility in organic solvents. The presence of the piperidinyloxy group may impart specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. The compound's molecular structure suggests it may engage in hydrogen bonding and other interactions, influencing its reactivity and stability. Additionally, its CAS number, 1283108-41-7, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, 4-Methyl-2-(4-piperidinyloxy)benzothiazole represents a class of compounds that may have significant implications in various fields, including pharmaceuticals and materials science.
Formula:C13H16N2OS
InChI:InChI=1S/C13H16N2OS/c1-9-3-2-4-11-12(9)15-13(17-11)16-10-5-7-14-8-6-10/h2-4,10,14H,5-8H2,1H3
InChI key:InChIKey=OOIGZBHIFOCXNE-UHFFFAOYSA-N
SMILES:CC1=C2C(SC(OC3CCNCC3)=N2)=CC=C1
Synonyms:
  • 4-Methyl-2-(4-piperidinyloxy)benzothiazole
  • Benzothiazole, 4-methyl-2-(4-piperidinyloxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.