CymitQuimica logo

CAS 1283108-45-1

:

1-(4-Methyl-2-benzothiazolyl)-3-azetidinecarboxylic acid

Description:
1-(4-Methyl-2-benzothiazolyl)-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a benzothiazole moiety and an azetidine ring. The presence of the methyl group on the benzothiazole contributes to its hydrophobic characteristics, while the carboxylic acid functional group enhances its polarity and solubility in polar solvents. This compound may exhibit biological activity due to its structural components, potentially interacting with various biological targets. Its molecular structure suggests it could participate in hydrogen bonding, influencing its reactivity and interactions in chemical processes. Additionally, the azetidine ring may impart strain, affecting the compound's stability and reactivity. The compound's specific applications and behavior in various environments would depend on its physicochemical properties, such as melting point, boiling point, and solubility, which are essential for understanding its potential uses in pharmaceuticals or agrochemicals. Overall, 1-(4-Methyl-2-benzothiazolyl)-3-azetidinecarboxylic acid represents a complex organic molecule with potential significance in various chemical and biological contexts.
Formula:C12H12N2O2S
InChI:InChI=1S/C12H12N2O2S/c1-7-3-2-4-9-10(7)13-12(17-9)14-5-8(6-14)11(15)16/h2-4,8H,5-6H2,1H3,(H,15,16)
InChI key:InChIKey=IOYFANQCZHJMFV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CN(C2=NC=3C(S2)=CC=CC3C)C1
Synonyms:
  • 1-(4-Methyl-2-benzothiazolyl)-3-azetidinecarboxylic acid
  • 3-Azetidinecarboxylic acid, 1-(4-methyl-2-benzothiazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.