CymitQuimica logo

CAS 1283108-49-5

:

N-Methyl-4-(4-methylphenyl)-4H-1,2,4-triazole-3-methanamine

Description:
N-Methyl-4-(4-methylphenyl)-4H-1,2,4-triazole-3-methanamine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a methyl group attached to the nitrogen atom of the triazole, as well as a 4-methylphenyl group, contributing to its aromatic properties. The presence of the methanamine functional group indicates that it has amine characteristics, which can influence its reactivity and solubility in various solvents. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, N-Methyl-4-(4-methylphenyl)-4H-1,2,4-triazole-3-methanamine represents a unique structure within the triazole class, with potential implications in medicinal chemistry.
Formula:C11H14N4
InChI:InChI=1S/C11H14N4/c1-9-3-5-10(6-4-9)15-8-13-14-11(15)7-12-2/h3-6,8,12H,7H2,1-2H3
InChI key:InChIKey=MUHSAVYQDKXRLU-UHFFFAOYSA-N
SMILES:C(NC)C=1N(C=NN1)C2=CC=C(C)C=C2
Synonyms:
  • 4H-1,2,4-Triazole-3-methanamine, N-methyl-4-(4-methylphenyl)-
  • N-Methyl-4-(4-methylphenyl)-4H-1,2,4-triazole-3-methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.