CAS 1283108-52-0

2-[(6-Methyl-2-pyridinyl)amino]-4-thiazolecarboxylic acid

Description:

2-[(6-Methyl-2-pyridinyl)amino]-4-thiazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids, such as potential acidity due to the carboxyl group and basicity from the amino group. The presence of the methyl group on the pyridine ring can influence its solubility and reactivity. It may also exhibit biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it could participate in hydrogen bonding, which may affect its interactions in biological systems. Additionally, its specific functional groups may contribute to its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. Overall, 2-[(6-Methyl-2-pyridinyl)amino]-4-thiazolecarboxylic acid represents a versatile compound with applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₀H₉N₃O₂S

InChI: InChI=1S/C10H9N3O2S/c1-6-3-2-4-8(11-6)13-10-12-7(5-16-10)9(14)15/h2-5H,1H3,(H,14,15)(H,11,12,13)

InChI key: InChIKey=JKIGWKNHNXUPOG-UHFFFAOYSA-N

SMILES: N(C1=NC(C(O)=O)=CS1)C=2N=C(C)C=CC2

Synonyms:

• 4-Thiazolecarboxylic acid, 2-[(6-methyl-2-pyridinyl)amino]-
• 2-[(6-Methyl-2-pyridinyl)amino]-4-thiazolecarboxylic acid
• 2-(6-Methylpyridin-2-ylamino)thiazole-4-carboxylic acid