CAS 1283108-54-2
:2-(Hydroxymethyl)-5-[(3-methoxyphenyl)methoxy]-4H-pyran-4-one
Description:
2-(Hydroxymethyl)-5-[(3-methoxyphenyl)methoxy]-4H-pyran-4-one, with the CAS number 1283108-54-2, is an organic compound characterized by its pyranone structure, which features a six-membered ring containing both oxygen and carbon atoms. This compound exhibits a hydroxymethyl group, contributing to its potential reactivity and solubility in polar solvents. The presence of the methoxyphenyl group enhances its aromatic characteristics, which may influence its electronic properties and interactions with other molecules. Typically, compounds of this nature can exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The specific functional groups present suggest potential applications in the synthesis of more complex molecules or as intermediates in organic synthesis. Additionally, the compound's structural features may allow for various chemical modifications, which could lead to derivatives with enhanced properties or activities. Overall, this compound represents a versatile structure within organic chemistry, with implications for both research and practical applications.
Formula:C14H14O5
InChI:InChI=1S/C14H14O5/c1-17-11-4-2-3-10(5-11)8-19-14-9-18-12(7-15)6-13(14)16/h2-6,9,15H,7-8H2,1H3
InChI key:InChIKey=ZEWWEQHOZDQDEV-UHFFFAOYSA-N
SMILES:C(OC=1C(=O)C=C(CO)OC1)C2=CC(OC)=CC=C2
Synonyms:- 4H-Pyran-4-one, 2-(hydroxymethyl)-5-[(3-methoxyphenyl)methoxy]-
- 2-(Hydroxymethyl)-5-[(3-methoxyphenyl)methoxy]-4H-pyran-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.