CymitQuimica logo

CAS 1283108-97-3

:

1-(4-Ethoxy-2-benzothiazolyl)-3-azetidinecarboxylic acid

Description:
1-(4-Ethoxy-2-benzothiazolyl)-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes an azetidine ring and a benzothiazole moiety. The presence of the ethoxy group enhances its solubility and may influence its biological activity. This compound is likely to exhibit properties typical of both azetidine derivatives and benzothiazole compounds, which are known for their diverse pharmacological activities, including antimicrobial and anti-inflammatory effects. The carboxylic acid functional group contributes to its acidity and potential reactivity, making it suitable for various chemical reactions, including esterification and amidation. Additionally, the compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions with biological targets would depend on the overall conformation and electronic properties imparted by the substituents on the benzothiazole and azetidine rings. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H14N2O3S
InChI:InChI=1S/C13H14N2O3S/c1-2-18-9-4-3-5-10-11(9)14-13(19-10)15-6-8(7-15)12(16)17/h3-5,8H,2,6-7H2,1H3,(H,16,17)
InChI key:InChIKey=CQNLMFJOGBAVJZ-UHFFFAOYSA-N
SMILES:O(CC)C1=C2C(SC(=N2)N3CC(C(O)=O)C3)=CC=C1
Synonyms:
  • 3-Azetidinecarboxylic acid, 1-(4-ethoxy-2-benzothiazolyl)-
  • 1-(4-Ethoxy-2-benzothiazolyl)-3-azetidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.