CAS 1283109-18-1
:2-(2-Aminoethyl)-6-(2,4-dimethyl-5-thiazolyl)-3(2H)-pyridazinone
Description:
2-(2-Aminoethyl)-6-(2,4-dimethyl-5-thiazolyl)-3(2H)-pyridazinone is a chemical compound characterized by its complex structure, which includes a pyridazinone core and a thiazole ring. This compound features an aminoethyl side chain, contributing to its potential biological activity. The presence of multiple methyl groups on the thiazole ring enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The thiazole and pyridazinone moieties suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound's specific properties, such as melting point, solubility, and reactivity, would depend on its molecular interactions and the environment in which it is studied. Additionally, the presence of functional groups may confer specific reactivity patterns, making it a candidate for further research in drug development or as a biochemical probe. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in organic chemistry.
Formula:C11H14N4OS
InChI:InChI=1S/C11H14N4OS/c1-7-11(17-8(2)13-7)9-3-4-10(16)15(14-9)6-5-12/h3-4H,5-6,12H2,1-2H3
InChI key:InChIKey=RVMWCJHSYRKGER-UHFFFAOYSA-N
SMILES:CC1=C(C2=NN(CCN)C(=O)C=C2)SC(C)=N1
Synonyms:- 2-(2-Aminoethyl)-6-(2,4-dimethyl-5-thiazolyl)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 2-(2-aminoethyl)-6-(2,4-dimethyl-5-thiazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.