CAS 1283109-19-2
:6-Oxo-3-(3-pyridinyl)-1(6H)-pyridazinebutanoic acid
Description:
6-Oxo-3-(3-pyridinyl)-1(6H)-pyridazinebutanoic acid is a chemical compound characterized by its unique structure, which includes a pyridazine ring and a pyridine substituent. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the 6-oxo group indicates a ketone functionality, which can influence its reactivity and stability. The molecular structure suggests potential interactions with biological targets, making it of interest in pharmaceutical research. Its solubility and stability in various solvents can vary, impacting its application in synthesis and biological assays. Additionally, the compound may exhibit specific pharmacological activities, which would require further investigation through experimental studies. Overall, 6-Oxo-3-(3-pyridinyl)-1(6H)-pyridazinebutanoic acid represents a complex organic molecule with potential utility in medicinal chemistry and related fields.
Formula:C13H13N3O3
InChI:InChI=1S/C13H13N3O3/c17-12-6-5-11(10-3-1-7-14-9-10)15-16(12)8-2-4-13(18)19/h1,3,5-7,9H,2,4,8H2,(H,18,19)
InChI key:InChIKey=ZBMMADRVGDWOGJ-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)N1N=C(C=CC1=O)C=2C=CC=NC2
Synonyms:- 1(6H)-Pyridazinebutanoic acid, 6-oxo-3-(3-pyridinyl)-
- 6-Oxo-3-(3-pyridinyl)-1(6H)-pyridazinebutanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.