CAS 1283109-23-8
:1-[4-(1-Methylethyl)-2-benzothiazolyl]-3-azetidinecarboxylic acid
Description:
1-[4-(1-Methylethyl)-2-benzothiazolyl]-3-azetidinecarboxylic acid, with the CAS number 1283109-23-8, is a chemical compound characterized by its unique structural features, including a benzothiazole moiety and an azetidine ring. The presence of the isopropyl group (1-methylethyl) contributes to its hydrophobic characteristics, while the carboxylic acid functional group imparts acidity and potential for hydrogen bonding. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, which are critical for its practical use in various chemical and biological contexts. Overall, the unique combination of functional groups in this compound positions it as a candidate for further investigation in medicinal chemistry and related fields.
Formula:C14H16N2O2S
InChI:InChI=1S/C14H16N2O2S/c1-8(2)10-4-3-5-11-12(10)15-14(19-11)16-6-9(7-16)13(17)18/h3-5,8-9H,6-7H2,1-2H3,(H,17,18)
InChI key:InChIKey=JRLHPQALTCDTEN-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C2C(SC(=N2)N3CC(C(O)=O)C3)=CC=C1
Synonyms:- 1-[4-(1-Methylethyl)-2-benzothiazolyl]-3-azetidinecarboxylic acid
- 3-Azetidinecarboxylic acid, 1-[4-(1-methylethyl)-2-benzothiazolyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.