CAS 1283109-43-2

1-(6-Ethoxy-2-benzothiazolyl)-3-azetidinecarboxylic acid

Description:

1-(6-Ethoxy-2-benzothiazolyl)-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a benzothiazole moiety and an azetidine ring. The presence of the ethoxy group enhances its solubility and may influence its biological activity. This compound is likely to exhibit properties typical of both heterocyclic compounds and carboxylic acids, such as potential acidity due to the carboxylic acid functional group and the ability to participate in various chemical reactions, including esterification and amide formation. Its benzothiazole component may contribute to specific pharmacological activities, as benzothiazoles are known for their diverse biological properties, including antimicrobial and anticancer activities. The azetidine ring adds to the compound's structural complexity and may affect its conformational flexibility and reactivity. Overall, this compound's characteristics suggest potential applications in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₃H₁₄N₂O₃S

InChI: InChI=1S/C13H14N2O3S/c1-2-18-9-3-4-10-11(5-9)19-13(14-10)15-6-8(7-15)12(16)17/h3-5,8H,2,6-7H2,1H3,(H,16,17)

InChI key: InChIKey=ZITAINHUNXRGAB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CN(C=2SC=3C(N2)=CC=C(OCC)C3)C1

Synonyms:

• 3-Azetidinecarboxylic acid, 1-(6-ethoxy-2-benzothiazolyl)-
• 1-(6-Ethoxy-2-benzothiazolyl)-3-azetidinecarboxylic acid