
CAS 1283180-64-2
:4-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrazinyl]morpholine
Description:
4-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrazinyl]morpholine is a chemical compound characterized by its unique structure, which includes a morpholine ring and a pyrazine moiety, along with a boron-containing dioxaborolane group. This compound is notable for its potential applications in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the boron atom in the dioxaborolane structure can enhance the compound's reactivity and stability, making it useful in various chemical reactions, including Suzuki coupling reactions. The morpholine ring contributes to the compound's solubility and biological activity, while the pyrazine unit may impart specific pharmacological properties. Overall, this compound exemplifies the integration of heterocyclic chemistry and organoboron chemistry, showcasing its relevance in contemporary chemical research and development. Its specific properties, such as melting point, solubility, and reactivity, would require experimental determination for precise applications.
Formula:C14H22BN3O3
InChI:InChI=1S/C14H22BN3O3/c1-13(2)14(3,4)21-15(20-13)11-9-17-12(10-16-11)18-5-7-19-8-6-18/h9-10H,5-8H2,1-4H3
InChI key:InChIKey=VIKHOGFHLCSSDL-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=NC(=CN2)N3CCOCC3
Synonyms:- Morpholine, 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrazinyl]-
- 4-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrazinyl]morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.