CAS 128350-88-9
:3-HYDROXY-2-OXO-3-TRIFLUOROMETHYL-6-METHYLINDOLINE
Description:
3-Hydroxy-2-oxo-3-trifluoromethyl-6-methylindoline, with the CAS number 128350-88-9, is a chemical compound that belongs to the indoline class of compounds. It features a fused bicyclic structure that includes an indole moiety, characterized by a nitrogen atom within the ring system. The presence of a trifluoromethyl group contributes to its unique electronic properties, enhancing its reactivity and potential applications in medicinal chemistry. The hydroxyl and keto functional groups indicate that this compound may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with biological targets. Additionally, the methyl group at the 6-position can affect the steric and electronic properties of the molecule. Overall, this compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and the unique characteristics imparted by its functional groups. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C10H8F3NO2
InChI:InChI=1/C10H8F3NO2/c1-5-2-3-6-7(4-5)14-8(15)9(6,16)10(11,12)13/h2-4,16H,1H3,(H,14,15)
SMILES:Cc1ccc2c(c1)N=C(C2(C(F)(F)F)O)O
Synonyms:- 2H-indol-2-one, 1,3-dihydro-3-hydroxy-6-methyl-3-(trifluoromethyl)-
- 3-Hydroxy-6-methyl-3-(trifluoromethyl)-1,3-dihydro-2H-indol-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-Indol-2-one, 1,3-dihydro-3-hydroxy-6-methyl-3-(trifluoromethyl)-
CAS:Formula:C10H8F3NO2Molecular weight:231.1712
