CAS 128350-90-3
:3-HYDROXY-2-OXO-3-TRIFLUOROMETHYL-7-METHYLINDOLINE
Description:
3-Hydroxy-2-oxo-3-trifluoromethyl-7-methylindoline, with the CAS number 128350-90-3, is a chemical compound that belongs to the indoline class of compounds. It features a distinctive indole structure, characterized by a fused benzene and pyrrole ring, which contributes to its aromatic properties. The presence of a trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The hydroxyl and keto functional groups suggest potential for hydrogen bonding, which may affect solubility and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its unique structural features could also lend themselves to applications in materials science or as intermediates in organic synthesis. However, specific data regarding its stability, reactivity, and toxicity would require further investigation through experimental studies or literature review. Overall, 3-hydroxy-2-oxo-3-trifluoromethyl-7-methylindoline represents a complex molecule with potential utility in various chemical and pharmaceutical applications.
Formula:C10H8F3NO2
InChI:InChI=1/C10H8F3NO2/c1-5-3-2-4-6-7(5)14-8(15)9(6,16)10(11,12)13/h2-4,16H,1H3,(H,14,15)
SMILES:Cc1cccc2c1N=C(C2(C(F)(F)F)O)O
Synonyms:- 2H-indol-2-one, 1,3-dihydro-3-hydroxy-7-methyl-3-(trifluoromethyl)-
- 3-Hydroxy-7-methyl-3-(trifluoromethyl)-1,3-dihydro-2H-indol-2-one
- 3-Hydroxy-7-Methyl-3-(Trifluoromethyl)Indolin-2-One
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-Indol-2-one, 1,3-dihydro-3-hydroxy-7-methyl-3-(trifluoromethyl)-
CAS:Formula:C10H8F3NO2Molecular weight:231.1712
