CAS 128366-51-8

3-[1-(1H-Imidazol-5-yl)ethyl]-2-methylbenzoic acid

Description:

3-[1-(1H-Imidazol-5-yl)ethyl]-2-methylbenzoic acid, with the CAS number 128366-51-8, is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a 2-methyl group and an imidazole-containing ethyl side chain. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid functional group. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. The imidazole ring can contribute to its ability to interact with biological macromolecules, such as proteins and enzymes. Additionally, the compound's melting point, boiling point, and stability under various conditions would depend on its specific molecular interactions and the presence of functional groups. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and materials science.

Formula: C₁₃H₁₄N₂O₂

InChI: InChI=1S/C13H14N2O2/c1-8-10(4-3-5-11(8)13(16)17)9(2)12-6-14-7-15-12/h3-7,9H,1-2H3,(H,14,15)(H,16,17)

InChI key: InChIKey=AKQQNNGMIFWCSO-UHFFFAOYSA-N

SMILES: C(C)(C1=C(C)C(C(O)=O)=CC=C1)C2=CN=CN2

Synonyms:

• Benzoic acid, 3-[1-(1H-imidazol-4-yl)ethyl]-2-methyl-
• Benzoic acid, 3-[1-(1H-imidazol-5-yl)ethyl]-2-methyl-
• 3-[1-(1H-Imidazol-5-yl)ethyl]-2-methylbenzoic acid

Medetomidine Impurity 52 HCl

CAS: 128366-51-8

Formula: C₁₃H₁₄N₂O₂·HCl

Color and Shape: White To Off-White Solid

Molecular weight: 230.27 36.46

Ref: 4Z-M-6859

3-[1-(1H-Imidazol-5-yl)ethyl]-2-methylbenzoic Acid

Controlled Product

CAS: 128366-51-8

Formula: C₁₃H₁₄N₂O₂

Color and Shape: Neat

Molecular weight: 230.262

Ref: TR-I350245