
CAS 1283719-73-2
:1,1-Dimethylethyl 2-(2,2,2-trifluoro-1-hydroxyethyl)-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 2-(2,2,2-trifluoro-1-hydroxyethyl)-1-pyrrolidinecarboxylate, identified by its CAS number 1283719-73-2, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and a trifluoroethyl group. This compound features a carboxylate functional group, which contributes to its potential reactivity and solubility properties. The presence of the trifluoroethyl moiety imparts distinctive electronic and steric characteristics, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The dimethyl substituents on the nitrogen atom of the pyrrolidine ring enhance its steric bulk, potentially influencing its biological activity and interaction with other molecules. Additionally, the compound's fluorinated groups may enhance lipophilicity and metabolic stability. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest for further research in synthetic chemistry and medicinal applications.
Formula:C11H18F3NO3
InChI:InChI=1S/C11H18F3NO3/c1-10(2,3)18-9(17)15-6-4-5-7(15)8(16)11(12,13)14/h7-8,16H,4-6H2,1-3H3
InChI key:InChIKey=VLUSRSVEVZDURI-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(O)C1N(C(OC(C)(C)C)=O)CCC1
Synonyms:- 1-Pyrrolidinecarboxylic acid, 2-(2,2,2-trifluoro-1-hydroxyethyl)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 2-(2,2,2-trifluoro-1-hydroxyethyl)-1-pyrrolidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.